3-Phenyl-N-(1-phenylpropan-2-yl)prop-2-yn-1-amine
 10681 C18H19N 249.35
 InChI=1S/C18H19N/c1-16(15-18-11-6-3-7-12-18)19-14-8-13-17-9-4-2-5-10-17/h2-7,9-12,16,19H,14-15H2,1H3
 CAEQOBRRUWRLKL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCC#Cc1ccccc1