N-(2-Phenoxyethyl)-1-phenylpropan-2-amine
 10679 C17H21NO 255.355
 InChI=1S/C17H21NO/c1-15(14-16-8-4-2-5-9-16)18-12-13-19-17-10-6-3-7-11-17/h2-11,15,18H,12-14H2,1H3
 YHKZKZUYFFWMPW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCCOc1ccccc1