4-Phenyl-N-(1-phenylpropan-2-yl)butan-1-amine
 10678 C19H25N 267.409
 InChI=1S/C19H25N/c1-17(16-19-13-6-3-7-14-19)20-15-9-8-12-18-10-4-2-5-11-18/h2-7,10-11,13-14,17,20H,8-9,12,15-16H2,1H3
 LFAVXHNZCYGUPI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCCCCc1ccccc1