N-(Cyclopropylmethyl)-1-phenylpropan-2-amine
 10677 C13H19N 189.297
 InChI=1S/C13H19N/c1-11(14-10-13-7-8-13)9-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3
 BYCDOXVZUHPDPT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCC1CC1