N-[(Adamantan-1-yl)methyl]-1-phenylpropan-2-amine
 10675 C20H29N 283.451
 InChI=1S/C20H29N/c1-15(7-16-5-3-2-4-6-16)21-14-20-11-17-8-18(12-20)10-19(9-17)13-20/h2-6,15,17-19,21H,7-14H2,1H3
 ISOADSNHMUZLGZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCC12CC3CC(C2)CC(C1)C3