5-Fluoro-N-(1-phenylpropan-2-yl)pentan-1-amine
 10674 C14H22FN 223.33
 InChI=1S/C14H22FN/c1-13(16-11-7-3-6-10-15)12-14-8-4-2-5-9-14/h2,4-5,8-9,13,16H,3,6-7,10-12H2,1H3
 XPVRVLWIHDTPGM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FCCCCCNC(Cc1ccccc1)C