3-Bromo-N-(1-phenylpropan-2-yl)propan-1-amine
 10671 C12H18BrN 256.182
 InChI=1S/C12H18BrN/c1-11(14-9-5-8-13)10-12-6-3-2-4-7-12/h2-4,6-7,11,14H,5,8-10H2,1H3
 FPMVHHJZKRYDFU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 BrCCCNC(Cc1ccccc1)C