N-(2-Bromoethyl)-1-phenylpropan-2-amine
 10670  C11H16BrN  242.155
 InChI=1S/C11H16BrN/c1-10(13-8-7-12)9-11-5-3-2-4-6-11/h2-6,10,13H,7-9H2,1H3
 FDSBFUATMOYWDQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 BrCCNC(Cc1ccccc1)C