3-[(1-Phenylpropan-2-yl)amino]propan-1-ol
 10669 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-11(13-8-5-9-14)10-12-6-3-2-4-7-12/h2-4,6-7,11,13-14H,5,8-10H2,1H3
 FKBKVVBSBXHGHP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCCCNC(Cc1ccccc1)C