N-(2-Methoxyethyl)-1-phenylpropan-2-amine
 10668 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-11(13-8-9-14-2)10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3
 KIABFHXPDLBMLA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCCNC(Cc1ccccc1)C