2-Methyl-N-(1-phenylpropan-2-yl)propan-1-amine
 10667 C13H21N 191.313
 InChI=1S/C13H21N/c1-11(2)10-14-12(3)9-13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3
 GOERKPWLLTTYBC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCC(C)C