N-(1-Phenylpropan-2-yl)cyclobutanamine
 10663 C13H19N 189.297
 InChI=1S/C13H19N/c1-11(14-13-8-5-9-13)10-12-6-3-2-4-7-12/h2-4,6-7,11,13-14H,5,8-10H2,1H3
 QTUXPJZFZNBOLH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NC1CCC1