N-(1-Phenylpropan-2-yl)cyclopropanamine
 10662 C12H17N 175.27
 InChI=1S/C12H17N/c1-10(13-12-7-8-12)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3
 BQBMHXPQOHGEAV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NC1CC1