Benzylamphetamine
N-Benzyl-1-phenylpropan-2-amine
 10659 C16H19N 225.329
 InChI=1S/C16H19N/c1-14(12-15-8-4-2-5-9-15)17-13-16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3
 JLCDKDGHTWGGQM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCc1ccccc1