Isopropylamphetamine
1-Phenyl-N-(propan-2-yl)propan-2-amine
 10656 C12H19N 177.286
 InChI=1S/C12H19N/c1-10(2)13-11(3)9-12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3
 PJXXJRMRHFYMEY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NC(C)C