1-[4-(2-Aminopropyl)phenyl]propan-2-ol
 10557 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(13)7-11-3-5-12(6-4-11)8-10(2)14/h3-6,9-10,14H,7-8,13H2,1-2H3
 RNWNYHJGJWWUHV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)CC(O)C)N