3-(2-Aminopropyl)aniline
 10507 C9H14N2 150.221
 InChI=1S/C9H14N2/c1-7(10)5-8-3-2-4-9(11)6-8/h2-4,6-7H,5,10-11H2,1H3
 SZSWEYKUELOAGN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)N)N