DOPF-2
1-[4-(2-Fluoropropyl)-2,5-dimethoxyphenyl]propan-2-amine
 10324  C14H22FNO2  255.328
 InChI=1S/C14H22FNO2/c1-9(15)5-11-7-14(18-4)12(6-10(2)16)8-13(11)17-3/h7-10H,5-6,16H2,1-4H3
 GHTLUDSPWKVFAY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(F)C)c(cc1CC(N)C)OC