4-Methyl-2-{2-[(propan-2-yl)amino]ethyl}phenol
 10100 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(2)13-7-6-11-8-10(3)4-5-12(11)14/h4-5,8-9,13-14H,6-7H2,1-3H3
 JLUDCIFCCREYAG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCCc1cc(C)ccc1O)C