2-(2,6-Dimethylphenoxy)cyclopropan-1-amine
 10007 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-7-4-3-5-8(2)11(7)13-10-6-9(10)12/h3-5,9-10H,6,12H2,1-2H3
 HPVILXPGAGEXFD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1Oc1c(C)cccc1C