3-Benzylpiperidine
 10001 C12H17N 175.27
 InChI=1S/C12H17N/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12/h1-3,5-6,12-13H,4,7-10H2
 BKDMXVREWXKZLB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCC(CN1)Cc1ccccc1