1-[2-(2-Ethyl-5-propoxy-1-benzofuran-4-yl)cyclopropyl]methanamine
 9661 C17H23NO2 273.37
 InChI=1S/C17H23NO2/c1-3-7-19-16-6-5-15-14(9-12(4-2)20-15)17(16)13-8-11(13)10-18/h5-6,9,11,13H,3-4,7-8,10,18H2,1-2H3
 NGMJOSJMPXNSEZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc2c(c1C1CC1CN)cc(o2)CC