BnCP
1-(1-Benzylcyclohexyl)piperidine
 960 C18H27N 257.414
 InChI=1S/C18H27N/c1-4-10-17(11-5-1)16-18(12-6-2-7-13-18)19-14-8-3-9-15-19/h1,4-5,10-11H,2-3,6-9,12-16H2
 XYIUBCYNWDTIAX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCC(CC1)(Cc1ccccc1)N1CCCCC1