RTI-32 2-propyl
(2S,3S)-8-Methyl-3-(4-methylphenyl)-2-propyl-8-azabicyclo[3.2.1]octane
 8729 C18H27N 257.414
 InChI=1S/C18H27N/c1-4-5-16-17(14-8-6-13(2)7-9-14)12-15-10-11-18(16)19(15)3/h6-9,15-18H,4-5,10-12H2,1-3H3/t15?,16-,17+,18?/m0/s1
 QCRUGFCHRLZVTK-JDEYZFBPSA-N This stereoisomer Any stereoisomer
 CCC[C@@H]1C2CCC(N2C)C[C@@H]1c1ccc(cc1)C