6-Me-2,4-DEPEA
2-(2,4-Diethoxy-6-methylphenyl)ethan-1-amine
 7806 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-4-15-11-8-10(3)12(6-7-14)13(9-11)16-5-2/h8-9H,4-7,14H2,1-3H3
 PPNLDSPOCWRREN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OCC)cc(cc1C)OCC