4-Me-2,6-MEA
1-(2-Ethoxy-6-methoxy-4-methylphenyl)propan-2-amine
 7804 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-16-13-7-9(2)6-12(15-4)11(13)8-10(3)14/h6-7,10H,5,8,14H2,1-4H3
 GYWZZIQOMAMUHB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(C)cc(c1CC(N)C)OC