2,3,6-DOET
1-(2-Ethyl-3,6-dimethoxyphenyl)propan-2-amine
 7732 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-10-11(8-9(2)14)13(16-4)7-6-12(10)15-3/h6-7,9H,5,8,14H2,1-4H3
 CKAFMNFGXWBHCM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1CC)CC(N)C)OC