BHB
1-(2,5-Dibutoxy-4-hexylphenyl)propan-2-amine
 7425  C23H41NO2  363.577
 InChI=1S/C23H41NO2/c1-5-8-11-12-13-20-17-23(26-15-10-7-3)21(16-19(4)24)18-22(20)25-14-9-6-2/h17-19H,5-16,24H2,1-4H3
 QAIDFXHPUMLDHL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCc1cc(OCCCC)c(cc1OCCCC)CC(N)C