ALEPH-S-amyl
1-[2,5-Dimethoxy-4-(pentylsulfanyl)phenyl]propan-2-amine
 7413  C16H27NO2S  297.456
 InChI=1S/C16H27NO2S/c1-5-6-7-8-20-16-11-14(18-3)13(9-12(2)17)10-15(16)19-4/h10-12H,5-9,17H2,1-4H3
 QJIMRIAYMMVZRY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCSc1cc(OC)c(cc1OC)CC(N)C