ALEPH-19
1-[4-(Butylsulfanyl)-2,5-dimethoxyphenyl]propan-2-amine
 7404  C15H25NO2S  283.43
 InChI=1S/C15H25NO2S/c1-5-6-7-19-15-10-13(17-3)12(8-11(2)16)9-14(15)18-4/h9-11H,5-8,16H2,1-4H3
 GHEFZUSLOGYDQM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCSc1cc(OC)c(cc1OC)CC(N)C