3,4-Dimethoxy-5-methylthioamphetamine; 3-T-TMA
1-[3,4-Dimethoxy-5-(methylsulfanyl)phenyl]propan-2-amine
 7014  C12H19NO2S  241.35
 InChI=1S/C12H19NO2S/c1-8(13)5-9-6-10(14-2)12(15-3)11(7-9)16-4/h6-8H,5,13H2,1-4H3
 BOCHGAGSMJJTOX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(OC)cc(cc1SC)CC(N)C