2,3,4-DOET
1-(2-Ethyl-3,4-dimethoxyphenyl)propan-2-amine
 7013 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-11-10(8-9(2)14)6-7-12(15-3)13(11)16-4/h6-7,9H,5,8,14H2,1-4H3
 KFYKQHRHEDMIKU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCc1c(ccc(c1OC)OC)CC(N)C