3,5-HPEA
5-(2-Aminoethyl)benzene-1,3-diol
 6920  C8H11NO2  153.178
 InChI=1S/C8H11NO2/c9-2-1-6-3-7(10)5-8(11)4-6/h3-5,10-11H,1-2,9H2
 MCRRJJIDXUJDBN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)cc(c1)O