1,4-Dimethoxy-2-(2-methylpropyl)-5-[(1E)-2-nitroprop-1-en-1-yl]benzene
 6763  C15H21NO4  279.332
 InChI=1S/C15H21NO4/c1-10(2)6-12-8-15(20-5)13(9-14(12)19-4)7-11(3)16(17)18/h7-10H,6H2,1-5H3/b11-7+
 RUONVNXICAFXHK-YRNVUSSQSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(C)C)c(cc1/C=C(/N(=O)=O)\C)OC