N,N-Me-3,4-EMPEA
2-(3-Ethoxy-4-methoxyphenyl)-N,N-dimethylethan-1-amine
 6630 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-16-13-10-11(8-9-14(2)3)6-7-12(13)15-4/h6-7,10H,5,8-9H2,1-4H3
 JVKFLDMSJWMYNM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CCN(C)C)ccc1OC