HME
5-(2-Amino-1-hydroxyethyl)-2-methoxyphenol
 6582  C9H13NO3  183.204
 InChI=1S/C9H13NO3/c1-13-9-3-2-6(4-7(9)11)8(12)5-10/h2-4,8,11-12H,5,10H2,1H3
 VSRZZLQWNRYVDK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccc(c(c1)O)OC)O