2-NO2-HPEA
2-(2-Aminoethyl)-5-nitrophenol
 6453  C8H10N2O3  182.177
 InChI=1S/C8H10N2O3/c9-4-3-6-1-2-7(10(12)13)5-8(6)11/h1-2,5,11H,3-4,9H2
 XTYIGRJAUIPHOY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1O)N(=O)=O