4C-2,3-DMPEA
1-(2,3-Dimethoxyphenyl)-N-methylbutan-2-amine
 6401 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-11(14-2)9-10-7-6-8-12(15-3)13(10)16-4/h6-8,11,14H,5,9H2,1-4H3
 VZITXQDEJMXSLF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1cccc(c1OC)OC)NC