DMT-4,7-dione
3-[2-(Dimethylamino)ethyl]-1H-indole-4,7-dione
 6400  C12H14N2O2  218.252
 InChI=1S/C12H14N2O2/c1-14(2)6-5-8-7-13-12-10(16)4-3-9(15)11(8)12/h3-4,7,13H,5-6H2,1-2H3
 UNNHIQBISLYKSC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1C(=O)C=CC2=O)C