α-EMTPEA
1-[4-(Methylsulfanyl)phenyl]butan-2-amine
 6359  C11H17NS  195.324
 InChI=1S/C11H17NS/c1-3-10(12)8-9-4-6-11(13-2)7-5-9/h4-7,10H,3,8,12H2,1-2H3
 DTEDVKORISMLCH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccc(cc1)SC)N