β-HO-N-Pr-PMA
1-(4-Methoxyphenyl)-2-(propylamino)propan-1-ol
 6314 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-4-9-14-10(2)13(15)11-5-7-12(16-3)8-6-11/h5-8,10,13-15H,4,9H2,1-3H3
 NTOKJLKDRLAIOC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC(C(c1ccc(cc1)OC)O)C