Ritalinic acid
Phenyl(piperidin-2-yl)acetic acid
 4381 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c15-13(16)12(10-6-2-1-3-7-10)11-8-4-5-9-14-11/h1-3,6-7,11-12,14H,4-5,8-9H2,(H,15,16)
 INGSNVSERUZOAK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC(=O)C(c1ccccc1)C1CCCCN1