1-[(1R,3s,5S)-3-Phenylbicyclo[3.1.0]hexan-3-yl]piperidine
 3369 C17H23N 241.371
 Arylcycloalkylamine
 InChI=1S/C17H23N/c1-3-7-16(8-4-1)17(12-14-11-15(14)13-17)18-9-5-2-6-10-18/h1,3-4,7-8,14-15H,2,5-6,9-13H2/t14-,15+,17-
 IQHBDLUJVLOBJA-SCAQPMJSSA-N This stereoisomer Any stereoisomer
 C1CCN(CC1)[C@@]1(C[C@@H]2[C@H](C1)C2)c1ccccc1