N-[1-(4-Acetylphenyl)propan-2-yl]acetamide
 2768 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-9(14-11(3)16)8-12-4-6-13(7-5-12)10(2)15/h4-7,9H,8H2,1-3H3,(H,14,16)
 GFXKTZQLBMPONQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)NC(Cc1ccc(cc1)C(=O)C)C