PRE-084
2-(Morpholin-4-yl)ethyl 1-phenylcyclohexane-1-carboxylate
 2697 C19H27NO3 317.423
 Arylcycloalkylamine
 InChI=1S/C19H27NO3/c21-18(23-16-13-20-11-14-22-15-12-20)19(9-5-2-6-10-19)17-7-3-1-4-8-17/h1,3-4,7-8H,2,5-6,9-16H2
 RQHKZUBCUZVZEF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(C1(CCCCC1)c1ccccc1)OCCN1CCOCC1