5-MeO-NEBF
N-Ethyl-2-(5-methoxy-1-benzofuran-3-yl)ethan-1-amine
 2691 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c1-3-14-7-6-10-9-16-13-5-4-11(15-2)8-12(10)13/h4-5,8-9,14H,3,6-7H2,1-2H3
 WXAZMCIXOIUGTM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1coc2c1cc(OC)cc2