4-Butoxynorephedrine
2-Amino-1-(4-butoxyphenyl)propan-1-ol
 2399 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-3-4-9-16-12-7-5-11(6-8-12)13(15)10(2)14/h5-8,10,13,15H,3-4,9,14H2,1-2H3
 PPUNXMIPIDSWAL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1ccc(cc1)C(C(N)C)O