2,3-Cl-PEA
2-(2,3-Dichlorophenyl)ethan-1-amine
 1558  C8H9Cl2N  190.07
 InChI=1S/C8H9Cl2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4-5,11H2
 WWRLSNWKOZHYIY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cccc(c1Cl)Cl