1,2,3,4,4a,5,6,10b-Octahydrobenzo[h]isoquinoline-7,8-diol
 1337 C13H17NO2 219.28
 InChI=1S/C13H17NO2/c15-12-4-3-9-10(13(12)16)2-1-8-5-6-14-7-11(8)9/h3-4,8,11,14-16H,1-2,5-7H2
 UBYDLPXWPINXGY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Oc1ccc2c(c1O)CCC1C2CNCC1