3-Ethylthio-4,5-dimethoxy-β-nitrostyrene
1-(Ethylsulfanyl)-2,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene
 12401  C12H15NO4S  269.317
 InChI=1S/C12H15NO4S/c1-4-18-11-8-9(5-6-13(14)15)7-10(16-2)12(11)17-3/h5-8H,4H2,1-3H3/b6-5+
 NOZTUQFTBSEPJS-AATRIKPKSA-N This stereoisomer Any stereoisomer
 CCSc1cc(/C=C/N(=O)=O)cc(c1OC)OC